For research use only. Not for therapeutic Use.
Biotin-PEG2-azide(CAT:I014189) is a bifunctional probe combining a biotin moiety with an azide group through a short PEG2 linker. The biotin tag allows high-affinity binding to streptavidin or avidin systems, enabling versatile detection, purification, and labeling strategies. The terminal azide enables bioorthogonal click chemistry reactions, such as copper-catalyzed azide–alkyne cycloaddition (CuAAC) or strain-promoted azide–alkyne cycloaddition (SPAAC). Its PEG2 spacer improves solubility and reduces steric hindrance, ensuring efficient biomolecular conjugation. This reagent is widely used in chemical biology, proteomics, imaging, and drug delivery research for precise functionalization of biomolecules with high specificity and compatibility in aqueous systems.
| CAS Number | 1910803-72-3 |
| Synonyms | N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| Molecular Formula | C16H28N6O4S |
| Purity | ≥95% |
| IUPAC Name | N-[2-[2-(2-azidoethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChI | InChI=1S/C16H28N6O4S/c17-22-19-6-8-26-10-9-25-7-5-18-14(23)4-2-1-3-13-15-12(11-27-13)20-16(24)21-15/h12-13,15H,1-11H2,(H,18,23)(H2,20,21,24) |
| InChIKey | OVEZMVONEJMGLZ-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCN=[N+]=[N-])NC(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
