For research use only. Not for therapeutic Use.
BIOTIN-PEG11-SH（Cat No.:I045131）is a heterobifunctional linker molecule composed of biotin, a polyethylene glycol (PEG<sub>11</sub>) spacer, and a terminal thiol (-SH) group. The biotin moiety enables high-affinity binding to streptavidin or avidin-conjugated surfaces, while the PEG<sub>11</sub> spacer provides enhanced solubility, reduced steric hindrance, and improved biocompatibility. The thiol group allows site-specific conjugation to maleimide-activated or gold surfaces via thiol-maleimide chemistry or thiol-gold interactions. BIOTIN-PEG11-SH is widely used in bioconjugation, surface functionalization, protein labeling, and biosensor development. Supplied for research in molecular biology, nanotechnology, and targeted delivery systems.
| CAS Number | 1650579-23-9 |
| Molecular Formula | C34H65N3O13S2 |
| Purity | ≥95% |
| IUPAC Name | 5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)-N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-sulfanylethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| InChI | InChI=1S/C34H65N3O13S2/c38-32(4-2-1-3-31-33-30(29-52-31)36-34(39)37-33)35-5-6-40-7-8-41-9-10-42-11-12-43-13-14-44-15-16-45-17-18-46-19-20-47-21-22-48-23-24-49-25-26-50-27-28-51/h30-31,33,51H,1-29H2,(H,35,38)(H2,36,37,39) |
| InChIKey | NUQCLJAPLBLADY-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCS)NC(=O)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
