Biochanin A (CAT: I003730) is a natural isoflavone compound found in various plants, including red clover and soybeans. It possesses several pharmacological activities, including antioxidant, anti-inflammatory, and estrogenic effects. Biochanin A has been studied for its potential health benefits, such as its role in cardiovascular health, cancer prevention, and bone health. It is also being investigated for its potential use in the management of menopausal symptoms and osteoporosis. Additionally, biochanin A has shown antimicrobial properties against certain pathogens. Its diverse pharmacological properties make biochanin A an interesting compound for further research and potential applications in various areas of health and medicine.
Catalog Number | I003730 |
CAS Number | 491-80-5 |
Synonyms | 4′-methyl Genistein;5,7-dihydroxy-4′-Methoxyisoflavone;NSC 123538 |
Molecular Formula | C16H12O5 |
Purity | 95% |
Target | FAAH |
Solubility | DMSO: ≥ 51 mg/mL |
Appearance | White solid |
Storage | 3 years -20C powder |
Analysis method | HPLC |
IC50 | 1.8/1.4/2.4 uM for mouse/Rat/Human FAAH [1] |
IUPAC Name | 5,7-dihydroxy-3-(4-methoxyphenyl)chromen-4-one |
InChI | InChI=1S/C16H12O5/c1-20-11-4-2-9(3-5-11)12-8-21-14-7-10(17)6-13(18)15(14)16(12)19/h2-8,17-18H,1H3 |
InChIKey | WUADCCWRTIWANL-UHFFFAOYSA-N |
SMILES | COC1=CC=C(C=C1)C2=COC3=CC(=CC(=C3C2=O)O)O |
Reference | <p style=”/line-height:25px/”> |