For research use only. Not for therapeutic Use.
BIO-013077-01（Cat No.:I015553）is a specialized chemical probe developed for research use in signal transduction and molecular pharmacology. It is designed to modulate specific intracellular pathways, providing insights into receptor activity, enzyme regulation, and cellular responses under physiological or disease conditions. With its defined structure and activity profile, BIO-013077-01 enables targeted studies in cell biology and drug discovery, particularly within oncology, immunology, and metabolic research. Although not intended for therapeutic application, it is a valuable tool compound that supports mechanistic investigations and the validation of potential therapeutic targets.
| CAS Number | 746667-48-1 |
| Synonyms | 6-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]quinoxaline |
| Molecular Formula | C17H13N5 |
| Purity | ≥95% |
| IUPAC Name | 6-[5-(6-methylpyridin-2-yl)-1H-pyrazol-4-yl]quinoxaline |
| InChI | InChI=1S/C17H13N5/c1-11-3-2-4-15(21-11)17-13(10-20-22-17)12-5-6-14-16(9-12)19-8-7-18-14/h2-10H,1H3,(H,20,22) |
| InChIKey | VXJLYXCHOKEODY-UHFFFAOYSA-N |
| SMILES | CC1=NC(=CC=C1)C2=C(C=NN2)C3=CC4=NC=CN=C4C=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
