For research use only. Not for therapeutic Use.
Bikaverin（Cat No.:I014176）is a natural red polyketide pigment produced by fungi such as Fusarium species, notable for its complex anthraquinone-like structure. It exhibits diverse biological activities, including antimicrobial, antifungal, anticancer, and antiparasitic effects, making it an attractive lead in drug discovery. Bikaverin has been studied for its ability to inhibit tumor cell proliferation, induce apoptosis, and suppress microbial growth. Beyond biomedical potential, it is also explored as a natural dye and biochemical probe. Its multifunctional properties highlight its importance in natural product chemistry and pharmacological research.
| CAS Number | 33390-21-5 |
| Synonyms | 7,10-dihydroxy-3,8-dimethoxy-1-methylbenzo[b]xanthene-6,11,12-trione |
| Molecular Formula | C20H14O8 |
| Purity | ≥95% |
| IUPAC Name | 7,10-dihydroxy-3,8-dimethoxy-1-methylbenzo[b]xanthene-6,11,12-trione |
| InChI | InChI=1S/C20H14O8/c1-7-4-8(26-2)5-10-12(7)17(23)15-18(24)13-9(21)6-11(27-3)16(22)14(13)19(25)20(15)28-10/h4-6,21-22H,1-3H3 |
| InChIKey | QXNACSREWQXWCV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1C(=O)C3=C(O2)C(=O)C4=C(C3=O)C(=CC(=C4O)OC)O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
