For research use only. Not for therapeutic Use.
BGN3（Cat No.:I044442）is a small-molecule inhibitor designed to target sodium-coupled monocarboxylate transporter 1 (SMCT1 or SLC5A8), a transporter responsible for the uptake of key monocarboxylates like butyrate, pyruvate, and lactate. By inhibiting SMCT1, BGN3 alters cellular metabolic flux and can influence histone acetylation through reduced short-chain fatty acid uptake, impacting gene expression and cell differentiation. It is particularly valuable in cancer and epigenetics research, where SLC5A8 functions as a tumor suppressor. BGN3 aids in exploring metabolic regulation, nutrient transport, and therapeutic modulation of epigenetic pathways in disease contexts.
| CAS Number | 1151762-33-2 |
| Synonyms | 6-[[4-(azidomethyl)phenyl]methoxy]-7H-purin-2-amine |
| Molecular Formula | C13H12N8O |
| Purity | ≥95% |
| IUPAC Name | 6-[[4-(azidomethyl)phenyl]methoxy]-7H-purin-2-amine |
| InChI | InChI=1S/C13H12N8O/c14-13-19-11-10(16-7-17-11)12(20-13)22-6-9-3-1-8(2-4-9)5-18-21-15/h1-4,7H,5-6H2,(H3,14,16,17,19,20) |
| InChIKey | DSPWEULBEPDTGO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=[N+]=[N-])COC2=NC(=NC3=C2NC=N3)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
