For research use only. Not for therapeutic Use.
Bexagliflozin (CAS 1118567-05-7) is a promising pharmaceutical compound in the class of sodium-glucose co-transporter 2 (SGLT2) inhibitors. As a selective SGLT2 inhibitor, it plays a crucial role in managing type 2 diabetes mellitus by reducing renal glucose reabsorption. By inhibiting SGLT2, Bexagliflozin promotes increased urinary glucose excretion, leading to improved glycemic control. The compound’s mechanism of action offers a unique approach to diabetes treatment, making it a valuable component in the evolving landscape of antidiabetic medications.
CAS Number | 1118567-05-7 |
Synonyms | EGT1442; THR-1442 |
Molecular Formula | C24H29ClO7 |
Purity | 98% |
Target | SGLT2 |
Target Protein | P31639 |
Appearance | Solid |
IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[4-(2-cyclopropyloxyethoxy)phenyl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
InChI | InChI=1S/C24H29ClO7/c25-19-8-3-15(24-23(29)22(28)21(27)20(13-26)32-24)12-16(19)11-14-1-4-17(5-2-14)30-9-10-31-18-6-7-18/h1-5,8,12,18,20-24,26-29H,6-7,9-11,13H2/t20-,21-,22+,23-,24+/m1/s1 |
InChIKey | BTCRKOKVYTVOLU-SJSRKZJXSA-N |
SMILES | C1CC1OCCOC2=CC=C(C=C2)CC3=C(C=CC(=C3)C4C(C(C(C(O4)CO)O)O)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |