For research use only. Not for therapeutic Use.
Beta-Phenylcinnamaldehyde(CAT: M050448) is a high-purity aromatic aldehyde widely employed in pharmaceutical, flavor, and fragrance research. This compound features a conjugated system with a phenyl group, making it a valuable intermediate in the synthesis of complex organic molecules. Its distinct structural properties allow for applications in designing novel therapeutic agents, studying reaction mechanisms, and developing advanced materials. With reliable stability and versatility, Beta-Phenylcinnamaldehyde is an essential building block for researchers and chemists working in drug discovery, fine chemicals, and innovative aromatic compound synthesis.
| CAS Number | 1210-39-5 |
| Molecular Formula | C15H12O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3,3-diphenylprop-2-enal |
| InChI | InChI=1S/C15H12O/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-12H |
| InChIKey | MWAFWBDWAWZJGK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=CC=O)C2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |