For research use only. Not for therapeutic Use.
Beta‑D‑Glucopyranosyl nitromethane（Cat No.:I045278）is a white to off‑white solid, a glycosylated derivative of nitromethane functioning as a strongly basic anion‑exchanger in hydroxide (OH) cycles. With the molecular formula C₇H₁₃NO₇ and a molecular weight of 223.18 g/mol, it dissolves in water up to ~31.25 mg/mL (~140 mM) when gently heated or sonicated. As a research reagent, it is used to explore glycosyl derivatives of nitromethane and their roles in anion‑exchange systems, offering versatility in biochemical and analytical studies.
| CAS Number | 81846-60-8 |
| Synonyms | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(nitromethyl)oxane-3,4,5-triol |
| Molecular Formula | C7H13NO7 |
| Purity | ≥95% |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-(nitromethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C7H13NO7/c9-2-4-6(11)7(12)5(10)3(15-4)1-8(13)14/h3-7,9-12H,1-2H2/t3-,4+,5-,6+,7+/m0/s1 |
| InChIKey | CNILFIXWGGSLAQ-PJEQPVAWSA-N |
| SMILES | C([C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)CO)O)O)O)[N+](=O)[O-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
