Beta-3-oxindolylalanine is a rare(Cat No.:M087499), non-proteinogenic amino acid derived from tryptophan metabolism. It is characterized by the presence of an oxindole group attached to the beta-carbon of alanine. This compound is of interest in biochemical research due to its unique structure and potential biological activities, including its roles in certain metabolic pathways in microorganisms and plants. Studies have explored its implications in neurodegenerative diseases and as a building block in peptide synthesis. Its distinctive structure allows for potential applications in medicinal chemistry, particularly in drug development and enzymatic studies.
Catalog Number | M087499 |
CAS Number | 32999-55-6 |
Synonyms | beta-3-oxindolylalanine |
Molecular Formula | C11H12N2O3 |
Purity | 95% |
Storage | Store at -20C |
Related CAS | 16008-59-6 |
IUPAC Name | 2-amino-3-(2-oxo-1,3-dihydroindol-3-yl)propanoic acid |
InChI | InChI=1S/C11H12N2O3/c12-8(11(15)16)5-7-6-3-1-2-4-9(6)13-10(7)14/h1-4,7-8H,5,12H2,(H,13,14)(H,15,16) |
InChIKey | SFJCKRJKEWLPTL-UHFFFAOYSA-N |
SMILES | C1=CC=C2C(=C1)C(C(=O)N2)CC(C(=O)O)N |