For research use only. Not for therapeutic Use.
Berberine-d6 chloride(Cat No.:S000314) is a deuterated form of berberine chloride, where six hydrogen atoms are replaced with deuterium, enhancing its molecular stability and utility as an analytical standard, especially in mass spectrometry and NMR spectroscopy. Berberine is a natural alkaloid found in various plants, used for its antimicrobial, anti-inflammatory, and anti-diabetic properties. The incorporation of deuterium into berberine-d6 chloride allows for more precise and detailed pharmacokinetic and metabolic studies, helping researchers to better understand the absorption, distribution, metabolism, and excretion of berberine in biological systems.
| Molecular Formula | C20H12D6ClNO4 |
| Purity | ≥95% |
| IUPAC Name | 16,17-bis(trideuteriomethoxy)-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene;chloride |
| InChI | InChI=1S/C20H18NO4.ClH/c1-22-17-4-3-12-7-16-14-9-19-18(24-11-25-19)8-13(14)5-6-21(16)10-15(12)20(17)23-2;/h3-4,7-10H,5-6,11H2,1-2H3;1H/q+1;/p-1/i1D3,2D3; |
| InChIKey | VKJGBAJNNALVAV-TXHXQZCNSA-M |
| SMILES | COC1=C(C2=C[N+]3=C(C=C2C=C1)C4=CC5=C(C=C4CC3)OCO5)OC.[Cl-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |