For research use only. Not for therapeutic Use.
Benzylthiouracil（Cat No.:I044738）is a synthetic derivative of thiouracil, a compound structurally related to uracil with a sulfur atom replacing one of the oxygen atoms. The addition of a benzyl group enhances its lipophilicity and potential biological activity. Benzylthiouracil has been investigated for its antithyroid properties, as thiouracil derivatives can inhibit thyroid hormone synthesis by interfering with iodine incorporation. It may also exhibit anticancer or antimicrobial effects due to its ability to interfere with nucleic acid metabolism. This compound is primarily used in research exploring thyroid regulation and heterocyclic drug design.
| CAS Number | 6336-50-1 |
| Synonyms | 6-benzyl-2-sulfanylidene-1H-pyrimidin-4-one |
| Molecular Formula | C11H10N2OS |
| Purity | ≥95% |
| IUPAC Name | 6-benzyl-2-sulfanylidene-1H-pyrimidin-4-one |
| InChI | InChI=1S/C11H10N2OS/c14-10-7-9(12-11(15)13-10)6-8-4-2-1-3-5-8/h1-5,7H,6H2,(H2,12,13,14,15) |
| InChIKey | PNXBXCRWXNESOV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=CC(=O)NC(=S)N2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
