For research use only. Not for therapeutic Use.
Benzyl-PEG4-Boc（Cat No.:I044640）is a monofunctional polyethylene glycol (PEG) derivative featuring a benzyl group and a Boc-protected amine, connected by a four-unit PEG spacer. The benzyl moiety offers hydrophobic character and can serve as a protecting or anchoring group, while the Boc (tert-butoxycarbonyl) group safeguards the amine from premature reactions and can be removed under mild acidic conditions to reveal a reactive primary amine. The PEG4 chain enhances water solubility, flexibility, and biocompatibility. This reagent is useful in bioconjugation, drug delivery development, and the synthesis of multifunctional molecules and polymer architectures.
| CAS Number | 2484091-04-3 |
| Synonyms | tert-butyl 3-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]propanoate |
| Molecular Formula | C20H32O6 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl 3-[2-[2-(2-phenylmethoxyethoxy)ethoxy]ethoxy]propanoate |
| InChI | InChI=1S/C20H32O6/c1-20(2,3)26-19(21)9-10-22-11-12-23-13-14-24-15-16-25-17-18-7-5-4-6-8-18/h4-8H,9-17H2,1-3H3 |
| InChIKey | QJABOSFLNXQSOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCC1=CC=CC=C1 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
