For research use only. Not for therapeutic Use.
Benzyl-PEG2-CH2COOH（Cat No.:I044521）is a bifunctional polyethylene glycol (PEG)-based linker molecule featuring a benzyl group on one end and a carboxylic acid group on the other, connected via a PEG2 (diethylene glycol) spacer. The benzyl moiety offers hydrophobicity and potential for π-stacking or conjugation to aromatic systems, while the carboxylic acid allows for coupling to amine-containing molecules through standard amide bond formation. The PEG2 spacer imparts flexibility and water solubility, making this compound ideal for bioconjugation, drug delivery systems, and the design of multifunctional molecular probes in chemical biology and pharmaceutical research.
| CAS Number | 91842-53-4 |
| Synonyms | 2-[2-(2-phenylmethoxyethoxy)ethoxy]acetic acid |
| Molecular Formula | C13H18O5 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-(2-phenylmethoxyethoxy)ethoxy]acetic acid |
| InChI | InChI=1S/C13H18O5/c14-13(15)11-18-9-7-16-6-8-17-10-12-4-2-1-3-5-12/h1-5H,6-11H2,(H,14,15) |
| InChIKey | JCPUGBBSZRZZNM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCCOCCOCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
