For research use only. Not for therapeutic Use.
Benzyl Benzoate(Cat No.:A000077)is a versatile compound widely used in pharmaceutical, cosmetic, and agricultural applications. As a topical treatment, it is effective against scabies and lice, working by disrupting the nervous system of mites and insects, leading to their death. Benzyl Benzoate also serves as a solvent and preservative in cosmetics and fragrances due to its stability and mild odor. In veterinary medicine, it is used to manage ectoparasitic infestations in livestock. Its multifunctional properties make it an essential ingredient in various therapeutic and industrial formulations.
CAS Number | 120-51-4 |
Synonyms | Ascabiol, Novoscabin, Scabitox, Benzoic acid benzyl ester |
Molecular Formula | C14H12O2 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Storage | Store at -20°C |
IUPAC Name | benzyl benzoate |
InChI | SESFRYSPDFLNCH-UHFFFAOYSA-N |
InChIKey | SESFRYSPDFLNCH-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC(=O)C2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |