For research use only. Not for therapeutic Use.
Benzyl alcohol-d₇（Cat No.:R071770）is a fully deuterated form of benzyl alcohol, in which all seven hydrogen atoms (five on the phenyl ring and two on the methylene group) are replaced by deuterium. This isotopically labeled compound is used as an internal standard in nuclear magnetic resonance (NMR) and mass spectrometry for accurate quantification and tracing in chemical, pharmaceutical, and environmental studies. It retains the same chemical reactivity and solvent properties as the non-deuterated form. Benzyl alcohol-d₇ is valuable in reaction mechanism studies, formulation analysis, and stability testing of pharmaceutical and cosmetic products.
| CAS Number | 71258-23-6 |
| Synonyms | dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanol |
| Molecular Formula | C7HD7O |
| Purity | ≥95% |
| IUPAC Name | dideuterio-(2,3,4,5,6-pentadeuteriophenyl)methanol |
| InChI | InChI=1S/C7H8O/c8-6-7-4-2-1-3-5-7/h1-5,8H,6H2/i1D,2D,3D,4D,5D,6D2 |
| InChIKey | WVDDGKGOMKODPV-XZJKGWKKSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C([2H])([2H])O)[2H])[2H] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
