Home
>
Chemical Reagents>Heterocycles> Benzyl ((3aS,4R,6S,6aR)-6-hydroxy-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)carbamate
For research use only. Not for therapeutic Use.
Benzyl ((3aS,4R,6S,6aR)-6-hydroxy-2,2-dimethyltetrahydro-3aH-cyclopenta[d][1,3]dioxol-4-yl)carbamate(Cat No.:L036156)is a chiral organic compound featuring a fused cyclopentane-dioxolane ring with a hydroxy group and a benzyl carbamate moiety. It is commonly used as a protected intermediate in asymmetric synthesis, particularly in the development of complex natural products or pharmaceutical agents. The benzyl group serves as a protecting group for the carbamate nitrogen, while the hydroxyl group allows further functionalization. This compound is valued for its stereochemical stability and synthetic versatility, often used in peptide chemistry and medicinal chemistry research applications.
CAS Number | 274693-53-7 |
Molecular Formula | C16H21NO5 |
Purity | ≥95% |
IUPAC Name | benzyl N-[(3aR,4S,6R,6aS)-4-hydroxy-2,2-dimethyl-4,5,6,6a-tetrahydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]carbamate |
InChI | InChI=1S/C16H21NO5/c1-16(2)21-13-11(8-12(18)14(13)22-16)17-15(19)20-9-10-6-4-3-5-7-10/h3-7,11-14,18H,8-9H2,1-2H3,(H,17,19)/t11-,12+,13+,14-/m1/s1 |
InChIKey | VPICQZQITAJOQA-ZOBORPQBSA-N |
SMILES | CC1(O[C@H]2[C@@H](C[C@@H]([C@H]2O1)O)NC(=O)OCC3=CC=CC=C3)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |