For research use only. Not for therapeutic Use.
Benzyl 3-Oxocyclobutylcarbamate（Cat No.:M132270）is a carbamate-protected cyclobutanone derivative featuring a benzyl group on the nitrogen atom. This compound is valued in synthetic organic chemistry as a versatile intermediate for constructing nitrogen-containing heterocycles and strained-ring systems. The cyclobutanone core offers unique reactivity due to its ring strain, making it suitable for ring-opening reactions, rearrangements, and pharmaceutical scaffold development. The benzyl carbamate group provides stability and can be readily removed under mild hydrogenolysis conditions. Supplied at high purity, it is ideal for research in medicinal chemistry and advanced synthetic methodologies.
| CAS Number | 130369-36-7 |
| Molecular Formula | C12H13NO3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | benzyl N-(3-oxocyclobutyl)carbamate |
| InChI | InChI=1S/C12H13NO3/c14-11-6-10(7-11)13-12(15)16-8-9-4-2-1-3-5-9/h1-5,10H,6-8H2,(H,13,15) |
| InChIKey | PSAMWNBBHLUISE-UHFFFAOYSA-N |
| SMILES | C1C(CC1=O)NC(=O)OCC2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
