Benzotriazole(Cat No.:R011787), is a versatile chemical compound with applications in various fields. It is an aromatic compound containing a triazole ring. Benzotriazole is known for its corrosion inhibition properties and is used as a corrosion inhibitor in industries such as aerospace and automotive. It’s also employed as a UV absorber and stabilizer in plastics, coatings, and textiles to prevent degradation caused by ultraviolet radiation. In addition, it finds use as a ligand in coordination chemistry and as a reagent in organic synthesis. Its multifunctional attributes make benzotriazole valuable in enhancing materials’ durability and stability.
Catalog Number | R011787 |
CAS Number | 95-14-7 |
Synonyms | 1,2,3-1H-Benzotriazole; 1,2,3-Triaza-1H-indene; 1,2-Aminoazophenylene; 1H-1,2,3-Benzotriazole; 2,3-Diazaindole; Azimidobenzene; Aziminobenzene; BLS 1326; Benzisotriazole; NSC 3058; Rusmin R; Seetec BT; |
Molecular Formula | C6H5N3 |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 2H-benzotriazole |
InChI | InChI=1S/C6H5N3/c1-2-4-6-5(3-1)7-9-8-6/h1-4H,(H,7,8,9) |
InChIKey | QRUDEWIWKLJBPS-UHFFFAOYSA-N |
SMILES | C1=CC2=NNN=C2C=C1 |
Reference | <span style=”font-family:arial,helvetica,sans-serif;”><span style=”font-size:12px;”>1.<span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”>Sease, Catherine. "Benzotriazole: A review for conservators." </span><i style=”font-family: Arial, sans-serif; font-size: 13px; font-variant-ligatures: normal; orphans: 2; widows: 2;”>Studies in Conservation</i><span style=”font-variant-ligatures: normal; orphans: 2; widows: 2;”> 23.2 (1978): 76-85.<br /> |