For research use only. Not for therapeutic Use.
Benzotriazol-1-yloxytris(dimethylamino)phosphonium hexafluorophosphate (Cat No.: R000032) is a powerful peptide coupling agent used in organic and medicinal chemistry. It facilitates the formation of amide bonds by activating carboxylic acids for reaction with amines, making it essential in peptide synthesis. The reagent contains a benzotriazole leaving group and a phosphonium core, promoting efficient coupling with minimal racemization. BOP is especially valued for its high reactivity, mild reaction conditions, and compatibility with diverse functional groups in solid-phase and solution-phase synthesis.
| CAS Number | 56602-33-6 |
| Synonyms | BOP; |
| Molecular Formula | C12H22F6N6OP2 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | benzotriazol-1-yloxy-tris(dimethylamino)phosphanium;hexafluorophosphate |
| InChI | InChI=1S/C12H22N6OP.F6P/c1-15(2)20(16(3)4,17(5)6)19-18-12-10-8-7-9-11(12)13-14-18;1-7(2,3,4,5)6/h7-10H,1-6H3;/q+1;-1 |
| InChIKey | MGEVGECQZUIPSV-UHFFFAOYSA-N |
| SMILES | CN(C)[P+](N(C)C)(N(C)C)ON1C2=CC=CC=C2N=N1.F[P-](F)(F)(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
