For research use only. Not for therapeutic Use.
Benzophenone imine (Cat No.: M068987) is an organic compound featuring a ketimine functional group derived from benzophenone, where the carbonyl oxygen is replaced by a nitrogen atom bearing a hydrogen. This pale yellow to colorless liquid is commonly used as a protected form of ammonia in organic synthesis, particularly in the formation of primary amines via alkylation or acylation followed by hydrolysis. Its stability and reactivity make it valuable in the synthesis of fine chemicals, pharmaceuticals, and nitrogen-containing heterocycles.
| CAS Number | 1013-88-3 |
| Molecular Formula | C13H11N |
| Purity | ≥95% |
| Storage | Room temperature |
| IUPAC Name | diphenylmethanimine |
| InChI | InChI=1S/C13H11N/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,14H |
| InChIKey | SXZIXHOMFPUIRK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=N)C2=CC=CC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
