For research use only. Not for therapeutic Use.
Benzo[a]pyrene-d12(Cat No.:R033882), is a deuterium-labeled derivative of benzo[a]pyrene, a polycyclic aromatic hydrocarbon (PAH) commonly found in combustion processes and environmental pollution. The deuterium-labeled compound serves as an isotopic internal standard in analytical chemistry and environmental monitoring. By using this labeled compound as a reference, researchers can accurately quantify and identify benzo[a]pyrene and related PAHs in samples using techniques like mass spectrometry. This aids in assessing the presence, distribution, and potential health risks associated with these compounds, as they are considered hazardous due to their carcinogenic and toxic properties.
Catalog Number | R033882 |
CAS Number | 63466-71-7 |
Synonyms | Perdeuterated benzo[a]pyrene; [12-2H]Benzo[a]pyrene |
Molecular Formula | C20H12 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 1,2,3,4,5,6,7,8,9,10,11,12-dodecadeuteriobenzo[a]pyrene |
InChI | InChI=1S/C20H12/c1-2-7-17-15(4-1)12-16-9-8-13-5-3-6-14-10-11-18(17)20(16)19(13)14/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D |
InChIKey | FMMWHPNWAFZXNH-AQZSQYOVSA-N |
SMILES | [2H]C1=C(C(=C2C3=C4C(=C(C2=C1[2H])[2H])C(=C(C5=C4C(=C(C(=C5[2H])[2H])[2H])C(=C3[2H])[2H])[2H])[2H])[2H])[2H] |