For research use only. Not for therapeutic Use.
Benzidine sulfone（Cat No.:L019358）is an organic compound derived from benzidine through sulfonation, typically forming a sulfone bridge between the aromatic rings. Its structure consists of two benzene rings connected via a sulfone (-SO₂-) group, enhancing its thermal and chemical stability. Benzidine sulfone is primarily used as an intermediate in the synthesis of specialty dyes, pigments, and polymers, especially those requiring high-performance materials. Due to its rigid aromatic framework and electron-withdrawing sulfone functionality, it contributes to colorfastness and heat resistance in final products. Proper handling is essential due to potential toxicological concerns.
| CAS Number | 6259-19-4 |
| Molecular Formula | C12H10N2O2S |
| Purity | ≥95% |
| IUPAC Name | 5,5-dioxodibenzothiophene-3,7-diamine |
| InChI | InChI=1S/C12H10N2O2S/c13-7-1-3-9-10-4-2-8(14)6-12(10)17(15,16)11(9)5-7/h1-6H,13-14H2 |
| InChIKey | FUXZRRZSHWQAAA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)S(=O)(=O)C3=C2C=CC(=C3)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
