For research use only. Not for therapeutic Use.
Benzhydrol(CAT: R052019), also known as diphenylmethanol, is an aromatic secondary alcohol widely used as an intermediate in organic synthesis and pharmaceutical development. Its structure features a central hydroxyl group bonded to two phenyl rings, providing both reactivity and stability. Benzhydrol is commonly employed in Grignard reactions, asymmetric synthesis, and as a precursor to antihistamines and other bioactive compounds. It also serves as a valuable reagent in stereoselective transformations and polymer chemistry.
CAS Number | 91-01-0 |
Synonyms | α-Phenylbenzenemethanol; Benzhydryl Alcohol; Benzohydrol; Diphenylcarbinol; Diphenylmethanol; Diphenylmethyl Alcohol; Hydroxydiphenylmethane; NSC 32150; α-Phenylbenzenemethanol; α-Phenylbenzyl Alcohol; |
Molecular Formula | C13H12O |
Purity | ≥95% |
Documentation | |
Storage | -20°C |
IUPAC Name | diphenylmethanol |
InChI | InChI=1S/C13H12O/c14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10,13-14H |
InChIKey | QILSFLSDHQAZET-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C(C2=CC=CC=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |