For research use only. Not for therapeutic Use.
Benzene-1,3,5-tricarbohydrazide (Cat.No:L004115) is a significant compound in organic chemistry. Its unique structure, containing three hydrazide groups on a benzene ring, imparts specific reactivity and properties. This compound serves as a key building block in the synthesis of specialized molecules with various applications, including in the field of pharmaceuticals and materials science.
CAS Number | 36997-31-6 |
Molecular Formula | C9H12N6O3 |
Purity | ≥95% |
IUPAC Name | benzene-1,3,5-tricarbohydrazide |
InChI | InChI=1S/C9H12N6O3/c10-13-7(16)4-1-5(8(17)14-11)3-6(2-4)9(18)15-12/h1-3H,10-12H2,(H,13,16)(H,14,17)(H,15,18) |
InChIKey | MNBHRGAIQJFCIO-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C=C1C(=O)NN)C(=O)NN)C(=O)NN |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |