For research use only. Not for therapeutic Use.
Benzamide（Cat No.:A000006）is an aromatic amide with the molecular formula C7H7NO, consisting of a benzene ring bonded to a carboxamide group. It appears as a white crystalline solid, soluble in organic solvents and slightly soluble in water. Benzamide serves as a versatile intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. It is a structural motif in several bioactive compounds and has been studied for potential antipsychotic, anticancer, and antimicrobial properties. Its stability and reactivity make it valuable in medicinal chemistry and material science for developing functionalized aromatic compounds.
| CAS Number | 55-21-0 |
| Synonyms | NA |
| Molecular Formula | C7H7NO |
| Purity | ≥95% |
| Target | Epigenetics |
| Storage | Store at RT |
| IUPAC Name | benzamide |
| InChI | InChI=1S/C7H7NO/c8-7(9)6-4-2-1-3-5-6/h1-5H,(H2,8,9) |
| InChIKey | KXDAEFPNCMNJSK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
