For research use only. Not for therapeutic Use.
Bensulfuron-methyl is a selective herbicide used primarily in rice cultivation to control broadleaf weeds and sedges. It belongs to the sulfonylurea class of herbicides, which inhibit the acetolactate synthase (ALS) enzyme, essential for plant growth. By disrupting amino acid synthesis, it effectively halts weed development without harming the rice crop. Bensulfuron-methyl is widely used due to its high efficacy at low application rates and its ability to minimize environmental impact, making it a valuable tool in sustainable agriculture.
| CAS Number | 83055-99-6 |
| Synonyms | Escuri(TM), Londax(TM), Pilardax(TM), Bendas(TM) |
| Molecular Formula | C16H18N4O7S |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | methyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoylmethyl]benzoate |
| InChI | InChI=1S/C16H18N4O7S/c1-25-12-8-13(26-2)18-15(17-12)19-16(22)20-28(23,24)9-10-6-4-5-7-11(10)14(21)27-3/h4-8H,9H2,1-3H3,(H2,17,18,19,20,22) |
| InChIKey | XMQFTWRPUQYINF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=NC(=N1)NC(=O)NS(=O)(=O)CC2=CC=CC=C2C(=O)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |