For research use only. Not for therapeutic Use.
S-(2-Boronoethyl)-L-cysteine(CAT: 63107-40-4), also known as L-BEC, is a boron-containing amino acid analog of L-cysteine. It is a potent inhibitor of enzymes called serine proteases, which play a role in various physiological processes such as blood coagulation, fibrinolysis, and inflammation. By inhibiting these enzymes, L-BEC has potential therapeutic applications in treating thrombosis, stroke, and other cardiovascular diseases. L-BEC has also been shown to inhibit the growth of cancer cells and sensitize them to chemotherapy and radiation therapy. It is typically administered intravenously or orally and has a relatively short half-life in the body.
CAS Number | 63107-40-4 |
Synonyms | S-(2-boronoethyl)-L-cysteine |
Molecular Formula | C5H12BNO4S |
Purity | ≥95% |
Target | Arginase |
Solubility | Soluble in DMSO |
Storage | Store at -20°C |
IUPAC Name | (2R)-2-amino-3-(2-boronoethylsulfanyl)propanoic acid |
InChI | InChI=1S/C5H12BNO4S/c7-4(5(8)9)3-12-2-1-6(10)11/h4,10-11H,1-3,7H2,(H,8,9)/t4-/m0/s1 |
InChIKey | OTJHLDXXJHAZTN-BYPYZUCNSA-N |
SMILES | B(CCSCC(C(=O)O)N)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |