For research use only. Not for therapeutic Use.
BBS-4 (Cat No.:I004087) is a component of the BBSome complex, which regulates ciliary trafficking and signaling in human cells. Mutations in the BBS4 gene are directly linked to Bardet-Biedl syndrome, a rare multisystemic disorder characterized by retinal degeneration, obesity, renal dysfunction, and developmental abnormalities. BBS-4 plays a critical role in the assembly and stability of the BBSome, influencing cilia formation and function. As a molecular target, it is valuable for studying ciliopathies, cellular transport mechanisms, and the pathogenesis of rare genetic diseases.
| CAS Number | 402934-09-2 |
| Synonyms | (2R)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-1-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)pyrrolidine-2-carboxamide |
| Molecular Formula | C22H24N6O3 |
| Purity | ≥95% |
| IUPAC Name | (2R)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-1-(2-imidazol-1-yl-6-methylpyrimidin-4-yl)pyrrolidine-2-carboxamide |
| InChI | InChI=1S/C22H24N6O3/c1-15-11-20(26-22(25-15)27-10-8-23-13-27)28-9-2-3-17(28)21(29)24-7-6-16-4-5-18-19(12-16)31-14-30-18/h4-5,8,10-13,17H,2-3,6-7,9,14H2,1H3,(H,24,29)/t17-/m1/s1 |
| InChIKey | LBCGUKCXRVUULK-QGZVFWFLSA-N |
| SMILES | CC1=CC(=NC(=N1)N2C=CN=C2)N3CCC[C@@H]3C(=O)NCCC4=CC5=C(C=C4)OCO5 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
