For research use only. Not for therapeutic Use.
BAY 73-1449（Cat No.:I004043）, also known as Riociguat, is an orally active stimulator of soluble guanylate cyclase (sGC), a key enzyme in the nitric oxide (NO) signaling pathway. By directly stimulating sGC and sensitizing it to endogenous NO, BAY 73-1449 increases intracellular cyclic GMP levels, leading to vasodilation and antiproliferative effects. It has demonstrated therapeutic potential in pulmonary arterial hypertension (PAH) and chronic thromboembolic pulmonary hypertension (CTEPH). As a research tool, BAY 73-1449 is widely used to explore cardiovascular regulation, vascular remodeling, and NO–sGC–cGMP signaling mechanisms.
| CAS Number | 693790-96-4 |
| Synonyms | (2R)-3-phenyl-2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]propanoic acid |
| Molecular Formula | C26H23N3O3 |
| Purity | ≥95% |
| IUPAC Name | (2R)-3-phenyl-2-[[6-(4-phenylmethoxyphenyl)pyrimidin-4-yl]amino]propanoic acid |
| InChI | InChI=1S/C26H23N3O3/c30-26(31)24(15-19-7-3-1-4-8-19)29-25-16-23(27-18-28-25)21-11-13-22(14-12-21)32-17-20-9-5-2-6-10-20/h1-14,16,18,24H,15,17H2,(H,30,31)(H,27,28,29)/t24-/m1/s1 |
| InChIKey | RRYFPNITZGCUPZ-XMMPIXPASA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC2=NC=NC(=C2)C3=CC=C(C=C3)OCC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
