For research use only. Not for therapeutic Use.
Batatasin I（Cat No.:I044975）is a naturally occurring bibenzyl compound found in various plant species, including Dioscorea batatas and certain orchids. It exhibits diverse biological activities such as anti-inflammatory, antioxidant, antifungal, and anticancer effects. Batatasin I has been shown to inhibit cell proliferation and induce apoptosis in cancer models, making it a valuable candidate in oncology research. Its unique bibenzyl structure also contributes to interest in its biosynthesis and ecological roles. Commonly used in natural product and pharmacological studies, Batatasin I is supplied at high purity and is intended solely for in vitro and in vivo research use.
| CAS Number | 51415-00-0 |
| Synonyms | 2,5,7-trimethoxyphenanthren-3-ol |
| Molecular Formula | C17H16O4 |
| Purity | ≥95% |
| IUPAC Name | 2,5,7-trimethoxyphenanthren-3-ol |
| InChI | InChI=1S/C17H16O4/c1-19-12-6-11-5-4-10-7-15(20-2)14(18)9-13(10)17(11)16(8-12)21-3/h4-9,18H,1-3H3 |
| InChIKey | KGYHMWVRKYFQQR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)C=CC3=CC(=C(C=C32)O)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
