For research use only. Not for therapeutic Use.
Batabulin sodium（Cat No.:I045753）is a synthetic antimitotic agent that disrupts microtubule dynamics by binding to the colchicine site of tubulin. This inhibition interferes with mitotic spindle formation, leading to cell cycle arrest and apoptosis in rapidly dividing cells. Developed as a potential anticancer compound, batabulin sodium has been investigated for its ability to suppress tumor growth and overcome resistance to other chemotherapeutics. The sodium salt form enhances solubility and formulation for research applications. Its mechanism highlights the therapeutic potential of targeting microtubules in oncology drug discovery.
| CAS Number | 195533-98-3 |
| Synonyms | sodium;(3-fluoro-4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide |
| Molecular Formula | C13H6F6NNaO3S |
| Purity | ≥95% |
| IUPAC Name | sodium;(3-fluoro-4-methoxyphenyl)-(2,3,4,5,6-pentafluorophenyl)sulfonylazanide |
| InChI | InChI=1S/C13H6F6NO3S.Na/c1-23-7-3-2-5(4-6(7)14)20-24(21,22)13-11(18)9(16)8(15)10(17)12(13)19;/h2-4H,1H3;/q-1;+1 |
| InChIKey | UWPXRVDIKGZQQW-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)[N-]S(=O)(=O)C2=C(C(=C(C(=C2F)F)F)F)F)F.[Na+] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
