For research use only. Not for therapeutic Use.
BAMEA-O16B(Cat No.:I044426)is a dendrimer-like, branched cationic lipid designed for efficient gene and nucleic acid delivery. Its unique structure, featuring multiple amine groups and hydrophobic alkyl chains, enhances the formation of stable complexes with DNA or RNA, facilitating cellular uptake and endosomal escape. BAMEA-O16B is particularly effective in transfection applications, including mRNA delivery and gene editing systems such as CRISPR-Cas9. Its optimized balance of charge density and biocompatibility makes it a valuable tool in non-viral gene delivery research, supporting advancements in gene therapy, vaccine development, and nucleic acid-based therapeutics.
CAS Number | 2490668-30-7 |
Synonyms | 2-(dodecyldisulfanyl)ethyl 3-[2-[2-[bis[3-[2-(dodecyldisulfanyl)ethoxy]-3-oxopropyl]amino]ethyl-methylamino]ethylamino]propanoate |
Molecular Formula | C56H111N3O6S6 |
Purity | ≥95% |
IUPAC Name | 2-(dodecyldisulfanyl)ethyl 3-[2-[2-[bis[3-[2-(dodecyldisulfanyl)ethoxy]-3-oxopropyl]amino]ethyl-methylamino]ethylamino]propanoate |
InChI | InChI=1S/C56H111N3O6S6/c1-5-8-11-14-17-20-23-26-29-32-48-66-69-51-45-63-54(60)35-38-57-39-42-58(4)43-44-59(40-36-55(61)64-46-52-70-67-49-33-30-27-24-21-18-15-12-9-6-2)41-37-56(62)65-47-53-71-68-50-34-31-28-25-22-19-16-13-10-7-3/h57H,5-53H2,1-4H3 |
InChIKey | WBCDKXLTOZQTMM-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCSSCCOC(=O)CCNCCN(C)CCN(CCC(=O)OCCSSCCCCCCCCCCCC)CCC(=O)OCCSSCCCCCCCCCCCC |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |