For research use only. Not for therapeutic Use.
Bacimethrin(Cat No.:L019531)is a naturally occurring thiamine (vitamin B1) analog and antibiotic produced by certain bacterial species. It functions by inhibiting bacterial growth through interference with thiamine biosynthesis, making it a valuable compound in microbiology and antibiotic research. Bacimethrin is particularly useful in studying bacterial resistance mechanisms and the development of novel antimicrobial agents. Its structure mimics that of thiamine, allowing it to disrupt essential metabolic processes in bacteria. High purity and consistency make bacimethrin essential for research in drug discovery and microbial pathogenesis.
CAS Number | 3690-12-8 |
Molecular Formula | C6H9N3O2 |
Purity | ≥95% |
IUPAC Name | (4-amino-2-methoxypyrimidin-5-yl)methanol |
InChI | InChI=1S/C6H9N3O2/c1-11-6-8-2-4(3-10)5(7)9-6/h2,10H,3H2,1H3,(H2,7,8,9) |
InChIKey | ZPNHGSNYBLXGOL-UHFFFAOYSA-N |
SMILES | COC1=NC=C(C(=N1)N)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |