For research use only. Not for therapeutic Use.
β-Hydroxypropionic acid（Cat No.:R070084）, also known as 3-hydroxypropionic acid (3-HP), is a three-carbon organic acid with the molecular formula C3H6O3. It contains both a hydroxyl (-OH) group at the β-position and a carboxylic acid (-COOH) group, making it structurally similar to lactic acid but differing in the position of the hydroxyl group. This colorless, water-soluble compound is a valuable platform chemical in the production of biodegradable plastics, acrylic acid, and other industrial materials. It is produced biologically via microbial fermentation and is studied for its potential in sustainable chemical manufacturing.
| CAS Number | 503-66-2 |
| Synonyms | 3-Hydroxypropanoic acid, Hydracrylic acid, Ethylene lactic acid |
| Molecular Formula | C3H6O3 |
| Purity | ≥95% |
| Storage | RT |
| IUPAC Name | 3-hydroxypropanoic acid |
| InChI | InChI=1S/C3H6O3/c4-2-1-3(5)6/h4H,1-2H2,(H,5,6) |
| InChIKey | ALRHLSYJTWAHJZ-UHFFFAOYSA-N |
| SMILES | C(CO)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
