For research use only. Not for therapeutic Use.
Azido-PEG6-CH2COOH（Cat No.:I044548）is a heterobifunctional polyethylene glycol (PEG) linker featuring an azide group on one end and a carboxylic acid (CH₂COOH) on the other. The PEG6 spacer enhances solubility and provides flexible spacing between functional groups, minimizing steric hindrance. The azide group enables bioorthogonal conjugation via click chemistry (e.g., azide-alkyne cycloaddition), while the carboxyl group allows coupling to amines through carbodiimide-mediated reactions (e.g., EDC/NHS). Azido-PEG6-CH2COOH is ideal for bioconjugation, surface modification, and development of multifunctional biomaterials in chemical biology, drug delivery, and diagnostic applications.
| CAS Number | 880129-82-8 |
| Synonyms | 2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| Molecular Formula | C14H27N3O8 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChI | InChI=1S/C14H27N3O8/c15-17-16-1-2-20-3-4-21-5-6-22-7-8-23-9-10-24-11-12-25-13-14(18)19/h1-13H2,(H,18,19) |
| InChIKey | GXXXKIVNLFPCAG-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCC(=O)O)N=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
