For research use only. Not for therapeutic Use.
Azido-PEG4-(CH2)3-methyl ester（Cat No.:I015767）is a heterobifunctional PEG-based linker tailored for versatile bioconjugation. It contains a terminal azide group that undergoes efficient copper-catalyzed or strain-promoted click chemistry with alkynes, and a methyl ester group that can be hydrolyzed to a carboxylic acid for further functionalization. The PEG4 spacer provides hydrophilicity, flexibility, and reduced steric hindrance, ensuring solubility and accessibility in diverse environments. The additional (CH2)3 segment adds spacing and stability. This reagent is widely used in probe synthesis, biomaterials, drug delivery, and chemical biology applications requiring modular conjugation strategies.
| CAS Number | 1835759-71-1 |
| Synonyms | methyl 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]butanoate |
| Molecular Formula | C13H25N3O6 |
| Purity | ≥95% |
| IUPAC Name | methyl 4-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]butanoate |
| InChI | InChI=1S/C13H25N3O6/c1-18-13(17)3-2-5-19-7-9-21-11-12-22-10-8-20-6-4-15-16-14/h2-12H2,1H3 |
| InChIKey | PZVGELSZWFBVCY-UHFFFAOYSA-N |
| SMILES | COC(=O)CCCOCCOCCOCCOCCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
