For research use only. Not for therapeutic Use.
Azido-PEG3-aldehyde（Cat No.:I044622）is a bifunctional polyethylene glycol (PEG) linker featuring an azide (-N₃) group at one end and an aldehyde (-CHO) group at the other, connected by a triethylene glycol (PEG3) spacer. The azide group enables bioorthogonal click chemistry reactions, such as strain-promoted or copper-catalyzed azide-alkyne cycloaddition, while the aldehyde moiety can form stable Schiff bases or oximes with amines or hydrazines. Its hydrophilic PEG3 backbone enhances solubility and flexibility. Azido-PEG3-aldehyde is widely used in bioconjugation, targeted drug delivery, and the functionalization of biomolecules or surfaces.
| CAS Number | 1807530-10-4 |
| Synonyms | 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanal |
| Molecular Formula | C9H17N3O4 |
| Purity | ≥95% |
| IUPAC Name | 3-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]propanal |
| InChI | InChI=1S/C9H17N3O4/c10-12-11-2-5-15-7-9-16-8-6-14-4-1-3-13/h3H,1-2,4-9H2 |
| InChIKey | NYVGWHGMRDHPFF-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCN=[N+]=[N-])C=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
