For research use only. Not for therapeutic Use.
Azido-PEG2-CH2COOH(CAT: I017253) is a short, bifunctional PEG linker featuring a terminal azide group and a carboxylic acid group, enabling versatile chemical conjugation. The azide functionality allows bioorthogonal labeling through click chemistry (CuAAC or SPAAC), while the carboxyl group supports coupling to amines via amide bond formation. The PEG2 spacer provides improved water solubility, flexibility, and reduced steric hindrance, making it an effective linker for bioconjugation, drug delivery, and surface modification. Azido-PEG2-CH2COOH is widely applied in the preparation of antibody–drug conjugates, PEGylated peptides, probes, and nanomaterials, serving as a reliable reagent for chemical biology and biomedical research.
| CAS Number | 882518-90-3 |
| Synonyms | 2-[2-(2-azidoethoxy)ethoxy]acetic acid |
| Molecular Formula | C6H11N3O4 |
| Purity | ≥95% |
| IUPAC Name | 2-[2-(2-azidoethoxy)ethoxy]acetic acid |
| InChI | InChI=1S/C6H11N3O4/c7-9-8-1-2-12-3-4-13-5-6(10)11/h1-5H2,(H,10,11) |
| InChIKey | OCIIYNXOTJRSHW-UHFFFAOYSA-N |
| SMILES | C(COCCOCC(=O)O)N=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
