For research use only. Not for therapeutic Use.
Azido-PEG1-CH₂CO₂H(CAT: I017489) is a short, azide-functionalized polyethylene glycol (PEG) linker terminated with a carboxylic acid group. The azide moiety enables bioorthogonal conjugation through click chemistry (CuAAC or SPAAC), while the carboxylic acid allows further derivatization or coupling to amines via amide bond formation. With a single ethylene glycol unit, this compact PEG spacer provides minimal steric hindrance while improving solubility and flexibility in conjugates. Azido-PEG1-CH₂CO₂H is widely used in chemical biology, drug discovery, bioconjugation, and materials research to attach probes, labels, or biomolecules in a controlled and efficient manner.
| CAS Number | 79598-48-4 |
| Synonyms | 2-(2-azidoethoxy)acetic acid |
| Molecular Formula | C4H7N3O3 |
| Purity | ≥95% |
| IUPAC Name | 2-(2-azidoethoxy)acetic acid |
| InChI | InChI=1S/C4H7N3O3/c5-7-6-1-2-10-3-4(8)9/h1-3H2,(H,8,9) |
| InChIKey | USTXYASKHZDVMV-UHFFFAOYSA-N |
| SMILES | C(COCC(=O)O)N=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
