For research use only. Not for therapeutic Use.
Azido-PEG1-Boc（Cat No.:I015820）is a minimal heterobifunctional linker designed for efficient and orthogonal bioconjugation. It contains a terminal azide group for copper-catalyzed or strain-promoted click chemistry with alkynes, and a Boc-protected amine that can be selectively deprotected under mild conditions for further functionalization. The short PEG1 spacer imparts hydrophilicity and flexibility while minimizing steric hindrance, maintaining solubility and reactivity in both aqueous and organic environments. Compact yet versatile, Azido-PEG1-Boc is widely used in chemical biology, probe synthesis, proteomics, and drug discovery, supporting modular and controlled molecular engineering strategies.
| CAS Number | 1374658-85-1 |
| Synonyms | tert-butyl 3-(2-azidoethoxy)propanoate |
| Molecular Formula | C9H17N3O3 |
| Purity | ≥95% |
| IUPAC Name | tert-butyl 3-(2-azidoethoxy)propanoate |
| InChI | InChI=1S/C9H17N3O3/c1-9(2,3)15-8(13)4-6-14-7-5-11-12-10/h4-7H2,1-3H3 |
| InChIKey | YQLWGRGAPJGNNQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCN=[N+]=[N-] |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
