For research use only. Not for therapeutic Use.
AZD4625（Cat No.:I043558）is an investigational small molecule being studied for its potential in treating cancer, particularly in tumors with mutations in specific metabolic pathways. It targets the enzyme 6-phosphogluconate dehydrogenase (6PGD), which plays a role in cellular metabolism and the pentose phosphate pathway. By inhibiting 6PGD, AZD4625 aims to disrupt cancer cell metabolism, leading to reduced tumor growth and survival. Ongoing research is evaluating its efficacy, safety, and potential for clinical use, especially in cancers with metabolic dependencies. If successful, AZD4625 may offer a novel therapeutic approach for certain cancers.
| CAS Number | 2387927-95-7 |
| Synonyms | 1-[(4R,7S)-12-chloro-14-fluoro-13-(2-fluoro-6-hydroxyphenyl)-4-methyl-10-oxa-2,5,16,18-tetrazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19),16-pentaen-5-yl]prop-2-en-1-one |
| Molecular Formula | C24H21ClF2N4O3 |
| Purity | ≥95% |
| IUPAC Name | 1-[(4R,7S)-12-chloro-14-fluoro-13-(2-fluoro-6-hydroxyphenyl)-4-methyl-10-oxa-2,5,16,18-tetrazatetracyclo[9.7.1.02,7.015,19]nonadeca-1(18),11,13,15(19),16-pentaen-5-yl]prop-2-en-1-one |
| InChI | InChI=1S/C24H21ClF2N4O3/c1-3-16(33)30-10-13-7-8-34-23-19-22(28-11-29-24(19)31(13)9-12(30)2)21(27)18(20(23)25)17-14(26)5-4-6-15(17)32/h3-6,11-13,32H,1,7-10H2,2H3/t12-,13+/m1/s1 |
| InChIKey | KYVBBJIEKCCZTM-OLZOCXBDSA-N |
| SMILES | C[C@@H]1CN2[C@@H](CCOC3=C(C(=C(C4=C3C2=NC=N4)F)C5=C(C=CC=C5F)O)Cl)CN1C(=O)C=C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
