For research use only. Not for therapeutic Use.
AZD-9574（Cat No.:I043979）is a selective, oral inhibitor of the fibroblast growth factor receptor 4 (FGFR4), a receptor involved in the regulation of cell proliferation, survival, and differentiation. FGFR4 is frequently dysregulated in various cancers, including liver cancer, colorectal cancer, and other solid tumors. By inhibiting FGFR4, AZD-9574 aims to block the signaling pathways that drive tumor growth, metastasis, and resistance to therapy. In preclinical studies, AZD-9574 has shown promise in reducing tumor growth and enhancing the effectiveness of other cancer treatments. It is currently being evaluated in clinical trials for cancer therapy.
| CAS Number | 2756333-39-6 |
| Synonyms | 6-fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| Molecular Formula | C21H22F2N6O2 |
| Purity | ≥95% |
| IUPAC Name | 6-fluoro-5-[4-[(5-fluoro-2-methyl-3-oxo-4H-quinoxalin-6-yl)methyl]piperazin-1-yl]-N-methylpyridine-2-carboxamide |
| InChI | InChI=1S/C21H22F2N6O2/c1-12-20(30)27-18-14(25-12)4-3-13(17(18)22)11-28-7-9-29(10-8-28)16-6-5-15(21(31)24-2)26-19(16)23/h3-6H,7-11H2,1-2H3,(H,24,31)(H,27,30) |
| InChIKey | WXRCLFFPZXJCLS-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=C(C=C2)CN3CCN(CC3)C4=C(N=C(C=C4)C(=O)NC)F)F)NC1=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
