For research use only. Not for therapeutic Use.
Azaspiracid-3 (CAT: R067738) is a potent marine biotoxin belonging to the azaspiracid group, produced by dinoflagellates such as Azadinium spinosum. Structurally complex, it contains multiple ether rings and a unique spirocyclic unit, contributing to its high lipophilicity and cellular toxicity. AZA-3 accumulates in shellfish and poses a risk to human health, causing Azaspiracid Shellfish Poisoning (AZP) upon consumption. It disrupts cellular ion homeostasis and cytoskeletal integrity, making it a key molecule in toxicology and marine safety research. AZA-3 is also used as a reference standard in analytical testing and plays an essential role in environmental monitoring and food safety programs.
| CAS Number | 265996-93-8 |
| Synonyms | (-)-Azaspiracid 3; 22-Demethylazaspiracid; |
| Molecular Formula | C46H69NO12 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | InChI=1S/C46H69NO12/c1-26-19-35-40-37(24-44(57-40)30(5)18-27(2)25-47-44)55-43(22-26,54-35)23-29(4)39-28(3)13-15-45(51,58-39)41(50)36-21-34-33(52-36)20-31(6)46(56-34)17-16-42(59-46)14-9-11-32(53-42)10-7-8-12-38(48)49/h7,9-10,14,26-28,30-37,39-41,47,50-51H,4,8,11-13,15-25H2,1-3,5-6H3,(H,48,49)/b10-7+/t26-,27+,28+,30-,31+,32-,33+,34+,35+,36-,37+,39+,40+,41+,42+,43+,44-,45-,46-/m1/s1 |
| InChI | InChI=1S/C46H69NO12/c1-26-19-35-40-37(24-44(57-40)30(5)18-27(2)25-47-44)55-43(22-26,54-35)23-29(4)39-28(3)13-15-45(51,58-39)41(50)36-21-34-33(52-36)20-31(6)46(56-34)17-16-42(59-46)14-9-11-32(53-42)10-7-8-12-38(48)49/h7,9-11,26-28,30-37,39-41,47,50-51H,4,8,12-25H2,1-3,5-6H3,(H,48,49) |
| InChIKey | XGHMSEQYABFWLF-UHFFFAOYSA-N |
| SMILES | CC1CCC(OC1C(=C)CC23CC(CC(O2)C4C(O3)CC5(O4)C(CC(CN5)C)C)C)(C(C6CC7C(O6)CC(C8(O7)CCC9(O8)CC=CC(O9)C=CCCC(=O)O)C)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
