For research use only. Not for therapeutic Use.
Azaspiracid-2 (Cat No.:R067737) is a potent marine biotoxin belonging to the azaspiracid family, produced by marine dinoflagellates such as Azadinium spinosum. It accumulates in shellfish and poses a risk to human health through azaspiracid shellfish poisoning (AZP), characterized by severe gastrointestinal symptoms. Structurally, AZA-2 is a complex polyether compound, differing slightly from Azaspiracid-1 by a methyl group substitution. It exerts its toxic effects by disrupting cellular membranes and ion channels. AZA-2 is widely studied in marine toxin research, food safety monitoring, and toxicological assessments of contaminated seafood.
| CAS Number | 265996-92-7 |
| Synonyms | Azaspiracid-2 and 37-epi Azaspiracid-2; |
| Molecular Formula | C48H73NO12 |
| Purity | ≥95% |
| Storage | -20°C |
| InChI | InChI=1S/C48H73NO12/c1-26-16-34(11-9-10-12-40(50)51)55-44(21-26)13-14-47(61-44)32(7)19-35-36(58-47)20-38(54-35)43(52)48(53)33(8)18-29(4)41(60-48)30(5)23-45-22-27(2)17-37(56-45)42-39(57-45)24-46(59-42)31(6)15-28(3)25-49-46/h9,11,21,27-29,31-39,41-43,49,52-53H,5,10,12-20,22-25H2,1-4,6-8H3,(H,50,51)/b11-9+/t27-,28+,29+,31-,32+,33-,34-,35+,36+,37-,38-,39+,41+,42+,43+,44-,45+,46-,47-,48-/m1/s1 |
| InChIKey | HTORKLPLHJXOOZ-PPWLEYITSA-N |
| SMILES | C[C@@H]1C[C@@H]2[C@H]3[C@H](C[C@@]4(O3)[C@@H](C[C@@H](CN4)C)C)O[C@](C1)(O2)CC(=C)[C@@H]5[C@H](C[C@H]([C@@](O5)([C@H]([C@H]6C[C@H]7[C@@H](O6)C[C@@H]([C@@]8(O7)CC[C@@]9(O8)C=C(C[C@H](O9)/C=C/CCC(=O)O)C)C)O)O)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |