For research use only. Not for therapeutic Use.
AV023（Cat No.:I044007）is an investigational small molecule compound being studied for its potential therapeutic applications in oncology. It works by targeting specific molecular pathways that regulate tumor growth, survival, and resistance to treatment. AV023 is designed to inhibit key proteins or kinases involved in the progression of cancer, particularly in tumors that are resistant to conventional therapies. By modulating these pathways, AV023 aims to slow down cancer cell proliferation and improve the effectiveness of existing cancer treatments. It is being evaluated in preclinical and clinical studies for its potential in various cancer types.
| CAS Number | 1107710-62-2 |
| Synonyms | N-cyclohexyl-3-[3-[4-(2-ethoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
| Molecular Formula | C22H30N4O4 |
| Purity | ≥95% |
| IUPAC Name | N-cyclohexyl-3-[3-[4-(2-ethoxyethoxy)phenyl]-5-oxo-4H-1,2,4-triazin-6-yl]propanamide |
| InChI | InChI=1S/C22H30N4O4/c1-2-29-14-15-30-18-10-8-16(9-11-18)21-24-22(28)19(25-26-21)12-13-20(27)23-17-6-4-3-5-7-17/h8-11,17H,2-7,12-15H2,1H3,(H,23,27)(H,24,26,28) |
| InChIKey | PRBZQYGBPDJGLE-UHFFFAOYSA-N |
| SMILES | CCOCCOC1=CC=C(C=C1)C2=NN=C(C(=O)N2)CCC(=O)NC3CCCCC3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
