For research use only. Not for therapeutic Use.
Aumitin(Cat No.:I018123)is a diaminopyrimidine-based inhibitor of autophagy that acts by targeting complex I and inhibiting mitochondrial respiration. This compound inhibits starvation- and rapamycin-induced autophagy in a dose-dependent manner with IC50 values of 0.12 μM and 0.24 μM, respectively. Aumitin has potential as a therapeutic agent for treating autophagy-related diseases, such as cancer, neurodegenerative disorders, and infections.
| CAS Number | 946293-78-3 |
| Molecular Formula | C₂₄H₂₀ClN₅O |
| Purity | ≥95% |
| Target | Autophagy |
| IUPAC Name | N-[4-[(4-anilino-6-methylpyrimidin-2-yl)amino]phenyl]-2-chlorobenzamide |
| InChI | InChI=1S/C24H20ClN5O/c1-16-15-22(27-17-7-3-2-4-8-17)30-24(26-16)29-19-13-11-18(12-14-19)28-23(31)20-9-5-6-10-21(20)25/h2-15H,1H3,(H,28,31)(H2,26,27,29,30) |
| InChIKey | VJNNQBDSUIVCKB-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC2=CC=C(C=C2)NC(=O)C3=CC=CC=C3Cl)NC4=CC=CC=C4 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |