For research use only. Not for therapeutic Use.
Atraric acid(Cat No.:R007198)is a naturally occurring phenolic compound, chemically known as methyl 2,4-dihydroxy-3,6-dimethylbenzoate. It is commonly found in lichens, particularly Evernia prunastri, and has been studied for its biological activities. Atraric acid exhibits antiandrogenic, anti-inflammatory, and antimicrobial properties, making it of interest in pharmaceutical and dermatological research. It has shown potential in the treatment of prostate disorders by acting as an androgen receptor antagonist. Additionally, its antioxidant capacity and presence in natural extracts contribute to its use in cosmetics, traditional medicine, and as a lead compound in drug development.
| CAS Number | 4707-47-5 |
| Molecular Formula | C10H12O4 |
| Purity | ≥95% |
| Target | Immunology/Inflammation |
| Storage | -20°C |
| IUPAC Name | methyl 2,4-dihydroxy-3,6-dimethylbenzoate |
| InChI | InChI=1S/C10H12O4/c1-5-4-7(11)6(2)9(12)8(5)10(13)14-3/h4,11-12H,1-3H3 |
| InChIKey | UUQHKWMIDYRWHH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C(=O)OC)O)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |