For research use only. Not for therapeutic Use.
Astragaloside III(Cat No.:I005068)is a bioactive compound extracted from the root of Astragalus membranaceus, a traditional herb used in Chinese medicine. It belongs to the group of saponins and is known for its antioxidant, anti-inflammatory, and immunomodulatory properties. Astragaloside III has been studied for its potential therapeutic effects in conditions such as cardiovascular diseases, diabetes, and neurodegenerative disorders. It is believed to improve immune function, protect against oxidative stress, and promote tissue repair. Research continues to explore its efficacy in enhancing overall health and longevity, particularly through its effects on the body’s inflammatory pathways.
| CAS Number | 84687-42-3 |
| Synonyms | AS-III;AST-III |
| Molecular Formula | C41H68O14 |
| Purity | ≥95% |
| Target | Disease Research Fields |
| Solubility | 10 mM in DMSO |
| Storage | -20°C |
| IUPAC Name | (2S,3R,4S,5S,6R)-2-[(2S,3R,4S,5R)-2-[[(1S,3R,6S,8R,9S,11S,12S,14S,15R,16R)-9,14-dihydroxy-15-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]-7,7,12,16-tetramethyl-6-pentacyclo[9.7.0.01,3.03,8.012,16]octadecanyl]oxy]-4,5-dihydroxyoxan-3-yl]oxy-6-(hydroxymethyl)oxane-3,4,5-triol |
| InChI | InChI=1S/C41H68O14/c1-35(2)24(53-34-30(26(46)21(45)17-51-34)54-33-29(49)28(48)27(47)22(16-42)52-33)9-11-41-18-40(41)13-12-37(5)32(39(7)10-8-25(55-39)36(3,4)50)20(44)15-38(37,6)23(40)14-19(43)31(35)41/h19-34,42-50H,8-18H2,1-7H3/t19-,20-,21+,22+,23-,24-,25-,26-,27+,28-,29+,30+,31-,32-,33-,34-,37+,38-,39+,40-,41+/m0/s1 |
| InChIKey | FVFSMBDVZVUETN-BQAOMNQWSA-N |
| SMILES | C[C@]12CC[C@@]34C[C@@]35CC[C@@H](C([C@@H]5[C@H](C[C@H]4[C@@]1(C[C@@H]([C@@H]2[C@]6(CC[C@H](O6)C(C)(C)O)C)O)C)O)(C)C)O[C@H]7[C@@H]([C@H]([C@@H](CO7)O)O)O[C@H]8[C@@H]([C@H]([C@@H]([C@H](O8)CO)O)O)O |
| Reference | <p style=/line-height:25px/> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |