For research use only. Not for therapeutic Use.
Astin C(CAT: I040861) is a bioactive cyclopeptide derived from Aster tataricus, known for its potent anti-inflammatory, immunomodulatory, and anticancer properties. It has been studied for its ability to inhibit NF-κB signaling, reducing inflammation and oxidative stress, making it a promising candidate for research in cancer, autoimmune diseases, and neuroinflammation. Astin C also exhibits cytotoxic activity against various tumor cells, contributing to its potential in oncology research. With its unique pharmacological profile, Astin C serves as a valuable tool for drug discovery and the development of novel therapeutic agents targeting inflammation and cancer progression.
CAS Number | 148057-23-2 |
Synonyms | (3S,10S,13S,16R,17S,18R)-17,18-dichloro-3,13-diethyl-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
Molecular Formula | C25H33Cl2N5O6 |
Purity | ≥95% |
IUPAC Name | 17,18-dichloro-3,13-diethyl-10-(hydroxymethyl)-7-phenyl-1,4,8,11,14-pentazabicyclo[14.3.0]nonadecane-2,5,9,12,15-pentone |
InChI | InChI=1S/C25H33Cl2N5O6/c1-3-15-22(35)31-18(12-33)23(36)30-17(13-8-6-5-7-9-13)10-19(34)28-16(4-2)25(38)32-11-14(26)20(27)21(32)24(37)29-15/h5-9,14-18,20-21,33H,3-4,10-12H2,1-2H3,(H,28,34)(H,29,37)(H,30,36)(H,31,35)/t14-,15+,16+,17?,18+,20-,21+/m1/s1 |
InChIKey | YWGAKIGNXGAAQR-DXSASFRHSA-N |
SMILES | CCC1C(=O)NC(C(=O)NC(CC(=O)NC(C(=O)N2CC(C(C2C(=O)N1)Cl)Cl)CC)C3=CC=CC=C3)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |